C27H27N2O4P — CID 68519667
6-diphenylphosphanyl-3,6-bis(2-oxopyrrolidin-1-yl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 68519667) has the molecular formula C27H27N2O4P and a molecular weight of 474.50 g/mol. Its IUPAC name is 6-diphenylphosphanyl-3,6-bis(2-oxopyrrolidin-1-yl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-diphenylphosphanyl-3,6-bis(2-oxopyrrolidin-1-yl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 68519667 |
| Molecular Formula | C27H27N2O4P |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 6-diphenylphosphanyl-3,6-bis(2-oxopyrrolidin-1-yl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=C(N2CCCC2=O)C=CC1(N1CCCC1=O)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27N2O4P/c30-24-13-7-17-28(24)20-15-16-27(23(19-20)26(32)33,29-18-8-14-25(29)31)34(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-6,9-12,15-16,19,23H,7-8,13-14,17-18H2,(H,32,33) |
| InChIKey | DGTZXYPVLZGELN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|