C12H14N2 — CID 68519754
8-methyl-2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 68519754) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 8-methyl-2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-methyl-2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68519754 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 8-methyl-2,3,4,4a-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)=C1CNCCC1N=2 |
| InChI | InChI=1S/C12H14N2/c1-8-2-3-11-9(6-8)10-7-13-5-4-12(10)14-11/h2-3,6,12-13H,4-5,7H2,1H3 |
| InChIKey | DPZHHIOJNDOSRU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |