About (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione
(6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione (PubChem CID 68519887) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione.
Molecular Properties
| Compound Name | (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione |
| PubChem CID | 68519887 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione |
| SMILES | CN1C(=O)C(Cc2ccccc2)N(C)C(=O)/C1=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N3O4/c1-21-17(12-14-8-4-3-5-9-14)19(24)22(2)18(20(21)25)13-15-10-6-7-11-16(15)23(26)27/h3-11,13,17H,12H2,1-2H3/b18-13- |
| InChIKey | UEVZSZFNEWNAND-AQTBWJFISA-N |
| XLogP | 2.48 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione?
The IUPAC name of (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione (CID 68519887) is (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione.
What is the SMILES notation for (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione?
The canonical SMILES for (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione is CN1C(=O)C(Cc2ccccc2)N(C)C(=O)/C1=C/c1ccccc1[N+](=O)[O-].
What is the InChIKey of (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione?
The InChIKey is UEVZSZFNEWNAND-AQTBWJFISA-N. The full InChI is InChI=1S/C20H19N3O4/c1-21-17(12-14-8-4-3-5-9-14)19(24)22(2)18(20(21)25)13-15-10-6-7-11-16(15)23(26)27/h3-11,13,17H,12H2,1-2H3/b18-13-.
What are the key properties of (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione?
(6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione has a molecular weight of 365.39 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-3-benzyl-1,4-dimethyl-6-[(2-nitrophenyl)methylidene]piperazine-2,5-dione is sourced from PubChem (CID 68519887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).