C22H24FN7O2S — CID 68519952
3-[[2-[5-[3-(dimethylamino)propoxy]-2-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiophene-2-carboxamide (PubChem CID 68519952) has the molecular formula C22H24FN7O2S and a molecular weight of 469.55 g/mol. Its IUPAC name is 3-[[2-[5-[3-(dimethylamino)propoxy]-2-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiophene-2-carboxamide.
| Compound Name | 3-[[2-[5-[3-(dimethylamino)propoxy]-2-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 68519952 |
| Molecular Formula | C22H24FN7O2S |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 3-[[2-[5-[3-(dimethylamino)propoxy]-2-fluoroanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiophene-2-carboxamide |
| SMILES | CN(C)CCCOc1ccc(F)c(Nc2nc(Nc3ccsc3C(N)=O)c3cc[nH]c3n2)c1 |
| InChI | InChI=1S/C22H24FN7O2S/c1-30(2)9-3-10-32-13-4-5-15(23)17(12-13)27-22-28-20-14(6-8-25-20)21(29-22)26-16-7-11-33-18(16)19(24)31/h4-8,11-12H,3,9-10H2,1-2H3,(H2,24,31)(H3,25,26,27,28,29) |
| InChIKey | ZAQKUTCNHZVKRL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|