About N-hydroxyethanimine oxide
N-hydroxyethanimine oxide (PubChem CID 6852034) has the molecular formula C2H5NO2
and a molecular weight of 75.07 g/mol. Its IUPAC name is N-hydroxyethanimine oxide.
Molecular Properties
| Compound Name | N-hydroxyethanimine oxide |
| PubChem CID | 6852034 |
| Molecular Formula | C2H5NO2 |
| Molecular Weight | 75.07 g/mol |
| Exact Mass | 75.03 |
| IUPAC Name | N-hydroxyethanimine oxide |
| SMILES | C/C=[N+](\[O-])O |
| InChI | InChI=1S/C2H5NO2/c1-2-3(4)5/h2H,1H3,(H,4,5) |
| InChIKey | CPZLOQHKKRZRSD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.07 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyethanimine oxide?
The IUPAC name of N-hydroxyethanimine oxide (CID 6852034) is N-hydroxyethanimine oxide.
What is the SMILES notation for N-hydroxyethanimine oxide?
The canonical SMILES for N-hydroxyethanimine oxide is C/C=[N+](\[O-])O.
What is the InChIKey of N-hydroxyethanimine oxide?
The InChIKey is CPZLOQHKKRZRSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2/c1-2-3(4)5/h2H,1H3,(H,4,5).
What are the key properties of N-hydroxyethanimine oxide?
N-hydroxyethanimine oxide has a molecular weight of 75.07 g/mol, XLogP of -0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyethanimine oxide is sourced from PubChem (CID 6852034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).