About 1-cyclohexyl-2,2-dimethoxyethanamine
1-cyclohexyl-2,2-dimethoxyethanamine (PubChem CID 68520972) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-dimethoxyethanamine.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,2-dimethoxyethanamine |
| PubChem CID | 68520972 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 1-cyclohexyl-2,2-dimethoxyethanamine |
| SMILES | COC(OC)C(N)C1CCCCC1 |
| InChI | InChI=1S/C10H21NO2/c1-12-10(13-2)9(11)8-6-4-3-5-7-8/h8-10H,3-7,11H2,1-2H3 |
| InChIKey | MJLMHEIMLDVTQN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2,2-dimethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,2-dimethoxyethanamine?
The IUPAC name of 1-cyclohexyl-2,2-dimethoxyethanamine (CID 68520972) is 1-cyclohexyl-2,2-dimethoxyethanamine.
What is the SMILES notation for 1-cyclohexyl-2,2-dimethoxyethanamine?
The canonical SMILES for 1-cyclohexyl-2,2-dimethoxyethanamine is COC(OC)C(N)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2,2-dimethoxyethanamine?
The InChIKey is MJLMHEIMLDVTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-12-10(13-2)9(11)8-6-4-3-5-7-8/h8-10H,3-7,11H2,1-2H3.
What are the key properties of 1-cyclohexyl-2,2-dimethoxyethanamine?
1-cyclohexyl-2,2-dimethoxyethanamine has a molecular weight of 187.28 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,2-dimethoxyethanamine is sourced from PubChem (CID 68520972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).