About methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate
methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate (PubChem CID 68521467) has the molecular formula C9H8BrN3O3
and a molecular weight of 286.09 g/mol. Its IUPAC name is methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate |
| PubChem CID | 68521467 |
| Molecular Formula | C9H8BrN3O3 |
| Molecular Weight | 286.09 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate |
| SMILES | COC(=O)Cn1c(=O)[nH]c2cc(Br)cnc21 |
| InChI | InChI=1S/C9H8BrN3O3/c1-16-7(14)4-13-8-6(12-9(13)15)2-5(10)3-11-8/h2-3H,4H2,1H3,(H,12,15) |
| InChIKey | UTDZCGUZOQQZLJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.09 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate?
The IUPAC name of methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate (CID 68521467) is methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate.
What is the SMILES notation for methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate?
The canonical SMILES for methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate is COC(=O)Cn1c(=O)[nH]c2cc(Br)cnc21.
What is the InChIKey of methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate?
The InChIKey is UTDZCGUZOQQZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3O3/c1-16-7(14)4-13-8-6(12-9(13)15)2-5(10)3-11-8/h2-3H,4H2,1H3,(H,12,15).
What are the key properties of methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate?
methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate has a molecular weight of 286.09 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-bromo-2-oxo-1H-imidazo[4,5-b]pyridin-3-yl)acetate is sourced from PubChem (CID 68521467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).