About (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid
(3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid (PubChem CID 68521770) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid.
Molecular Properties
| Compound Name | (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid |
| PubChem CID | 68521770 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid |
| SMILES | Cc1noc(NC(=O)O)c1C |
| InChI | InChI=1S/C6H8N2O3/c1-3-4(2)8-11-5(3)7-6(9)10/h7H,1-2H3,(H,9,10) |
| InChIKey | JGCVISBWPLKWOF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid?
The IUPAC name of (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid (CID 68521770) is (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid.
What is the SMILES notation for (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid?
The canonical SMILES for (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid is Cc1noc(NC(=O)O)c1C.
What is the InChIKey of (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid?
The InChIKey is JGCVISBWPLKWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-3-4(2)8-11-5(3)7-6(9)10/h7H,1-2H3,(H,9,10).
What are the key properties of (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid?
(3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid has a molecular weight of 156.14 g/mol, XLogP of 1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethyl-1,2-oxazol-5-yl)carbamic acid is sourced from PubChem (CID 68521770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).