C18H15Cl2N5O2 — CID 68522070
N-(2-cyanoethyl)-2-[6-(3,5-dichlorophenyl)-1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide (PubChem CID 68522070) has the molecular formula C18H15Cl2N5O2 and a molecular weight of 404.26 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[6-(3,5-dichlorophenyl)-1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[6-(3,5-dichlorophenyl)-1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 68522070 |
| Molecular Formula | C18H15Cl2N5O2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-(2-cyanoethyl)-2-[6-(3,5-dichlorophenyl)-1-methyl-2-oxoimidazo[4,5-b]pyridin-3-yl]acetamide |
| SMILES | Cn1c(=O)n(CC(=O)NCCC#N)c2ncc(-c3cc(Cl)cc(Cl)c3)cc21 |
| InChI | InChI=1S/C18H15Cl2N5O2/c1-24-15-7-12(11-5-13(19)8-14(20)6-11)9-23-17(15)25(18(24)27)10-16(26)22-4-2-3-21/h5-9H,2,4,10H2,1H3,(H,22,26) |
| InChIKey | UEQYHWDLHIIAGV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|