C19H15ClF2N6 — CID 6852209
8-N-(2-chlorophenyl)-2-N-(2,6-difluorophenyl)-9-ethylpurine-2,8-diamine (PubChem CID 6852209) has the molecular formula C19H15ClF2N6 and a molecular weight of 400.82 g/mol. Its IUPAC name is 8-N-(2-chlorophenyl)-2-N-(2,6-difluorophenyl)-9-ethylpurine-2,8-diamine.
| Compound Name | 8-N-(2-chlorophenyl)-2-N-(2,6-difluorophenyl)-9-ethylpurine-2,8-diamine |
|---|---|
| PubChem CID | 6852209 |
| Molecular Formula | C19H15ClF2N6 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 8-N-(2-chlorophenyl)-2-N-(2,6-difluorophenyl)-9-ethylpurine-2,8-diamine |
| SMILES | CCn1c(Nc2ccccc2Cl)nc2cnc(Nc3c(F)cccc3F)nc21 |
| InChI | InChI=1S/C19H15ClF2N6/c1-2-28-17-15(25-19(28)24-14-9-4-3-6-11(14)20)10-23-18(27-17)26-16-12(21)7-5-8-13(16)22/h3-10H,2H2,1H3,(H,24,25)(H,23,26,27) |
| InChIKey | ZWKOUFZHPNIQSH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |