C18H20O6 — CID 68522275
2,3-bis(2-hydroxypropyl)naphthalene-1,8-dicarboxylic acid (PubChem CID 68522275) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,3-bis(2-hydroxypropyl)naphthalene-1,8-dicarboxylic acid.
| Compound Name | 2,3-bis(2-hydroxypropyl)naphthalene-1,8-dicarboxylic acid |
|---|---|
| PubChem CID | 68522275 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,3-bis(2-hydroxypropyl)naphthalene-1,8-dicarboxylic acid |
| SMILES | CC(O)Cc1cc2cccc(C(=O)O)c2c(C(=O)O)c1CC(C)O |
| InChI | InChI=1S/C18H20O6/c1-9(19)6-12-8-11-4-3-5-13(17(21)22)15(11)16(18(23)24)14(12)7-10(2)20/h3-5,8-10,19-20H,6-7H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | AVLASMZBVBBXLS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |