About 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride
2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride (PubChem CID 68522489) has the molecular formula C6H11ClN2OS
and a molecular weight of 194.69 g/mol. Its IUPAC name is 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride |
| PubChem CID | 68522489 |
| Molecular Formula | C6H11ClN2OS |
| Molecular Weight | 194.69 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride |
| SMILES | CSc1ncc(CCN)o1.Cl |
| InChI | InChI=1S/C6H10N2OS.ClH/c1-10-6-8-4-5(9-6)2-3-7;/h4H,2-3,7H2,1H3;1H |
| InChIKey | FDMKJRHRSPVKEB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.69 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride (CID 68522489) is 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride is CSc1ncc(CCN)o1.Cl.
What is the InChIKey of 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride?
The InChIKey is FDMKJRHRSPVKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS.ClH/c1-10-6-8-4-5(9-6)2-3-7;/h4H,2-3,7H2,1H3;1H.
What are the key properties of 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride?
2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride has a molecular weight of 194.69 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylsulfanyl-1,3-oxazol-5-yl)ethanamine;hydrochloride is sourced from PubChem (CID 68522489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).