About 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid
4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid (PubChem CID 68522550) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid |
| PubChem CID | 68522550 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC1COC(=O)O1 |
| InChI | InChI=1S/C4H6O3.C4H6O2/c1-3-2-6-4(5)7-3;1-3(2)4(5)6/h3H,2H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | QIYMZTXOQUJMML-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid?
The IUPAC name of 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid (CID 68522550) is 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid.
What is the SMILES notation for 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid?
The canonical SMILES for 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CC1COC(=O)O1.
What is the InChIKey of 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid?
The InChIKey is QIYMZTXOQUJMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C4H6O2/c1-3-2-6-4(5)7-3;1-3(2)4(5)6/h3H,2H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid?
4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid has a molecular weight of 188.18 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dioxolan-2-one;2-methylprop-2-enoic acid is sourced from PubChem (CID 68522550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).