About 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one
6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 68522902) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 68522902 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CCC1C=c2cncnc2=NC1=O |
| InChI | InChI=1S/C10H9N3O/c1-2-3-7-4-8-5-11-6-12-9(8)13-10(7)14/h2,4-7H,1,3H2 |
| InChIKey | WWRKPTKXCBBVJQ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one (CID 68522902) is 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one is C=CCC1C=c2cncnc2=NC1=O.
What is the InChIKey of 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is WWRKPTKXCBBVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c1-2-3-7-4-8-5-11-6-12-9(8)13-10(7)14/h2,4-7H,1,3H2.
What are the key properties of 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one?
6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 187.20 g/mol, XLogP of -0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enyl-6H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 68522902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).