C20H23N3 — CID 68523002
(2S,6S)-N-benzyl-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine (PubChem CID 68523002) has the molecular formula C20H23N3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2S,6S)-N-benzyl-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine.
| Compound Name | (2S,6S)-N-benzyl-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine |
|---|---|
| PubChem CID | 68523002 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (2S,6S)-N-benzyl-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine |
| SMILES | c1ccc(CNc2cc3c4c(c2)[C@H]2CNC[C@H]2CN4CC3)cc1 |
| InChI | InChI=1S/C20H23N3/c1-2-4-14(5-3-1)10-22-17-8-15-6-7-23-13-16-11-21-12-19(16)18(9-17)20(15)23/h1-5,8-9,16,19,21-22H,6-7,10-13H2/t16-,19-/m0/s1 |
| InChIKey | JJPHJBFXIFMPSA-LPHOPBHVSA-N |
| XLogP | 2.98 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|