C25H30F3N3O3 — CID 68523754
1-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 68523754) has the molecular formula C25H30F3N3O3 and a molecular weight of 477.53 g/mol. Its IUPAC name is 1-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 68523754 |
| Molecular Formula | C25H30F3N3O3 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1-[4-hydroxy-4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(CC(=O)N3CCC(O)(c4cccc(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H30F3N3O3/c1-34-22-7-5-21(6-8-22)30-15-13-29(14-16-30)18-23(32)31-11-9-24(33,10-12-31)19-3-2-4-20(17-19)25(26,27)28/h2-8,17,33H,9-16,18H2,1H3 |
| InChIKey | WAPTWBGSVDCUOX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|