C15H18N2O — CID 68523887
(10S,14S)-12-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one (PubChem CID 68523887) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is (10S,14S)-12-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one.
| Compound Name | (10S,14S)-12-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one |
|---|---|
| PubChem CID | 68523887 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (10S,14S)-12-methyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one |
| SMILES | CN1C[C@@H]2c3cccc4c3N(CCC4)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C15H18N2O/c1-16-8-12-11-6-2-4-10-5-3-7-17(14(10)11)15(18)13(12)9-16/h2,4,6,12-13H,3,5,7-9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | OJUVWKQNXPABQJ-CHWSQXEVSA-N |
| XLogP | 1.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |