About 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione
5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione (PubChem CID 68523936) has the molecular formula C10H16Cl2N2O2
and a molecular weight of 267.16 g/mol. Its IUPAC name is 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione |
| PubChem CID | 68523936 |
| Molecular Formula | C10H16Cl2N2O2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione |
| SMILES | CC(C)CC(Cl)CC(Cl)C1NC(=O)NC1=O |
| InChI | InChI=1S/C10H16Cl2N2O2/c1-5(2)3-6(11)4-7(12)8-9(15)14-10(16)13-8/h5-8H,3-4H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | XOBKSECKNPZZDP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione?
The IUPAC name of 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione (CID 68523936) is 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione is CC(C)CC(Cl)CC(Cl)C1NC(=O)NC1=O.
What is the InChIKey of 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione?
The InChIKey is XOBKSECKNPZZDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16Cl2N2O2/c1-5(2)3-6(11)4-7(12)8-9(15)14-10(16)13-8/h5-8H,3-4H2,1-2H3,(H2,13,14,15,16).
What are the key properties of 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione?
5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione has a molecular weight of 267.16 g/mol, XLogP of 1.85, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dichloro-5-methylhexyl)imidazolidine-2,4-dione is sourced from PubChem (CID 68523936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).