C29H33F3O5Si — CID 68524081
(2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid (PubChem CID 68524081) has the molecular formula C29H33F3O5Si and a molecular weight of 546.66 g/mol. Its IUPAC name is (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid.
| Compound Name | (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 68524081 |
| Molecular Formula | C29H33F3O5Si |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid |
| SMILES | COCO[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C(=O)O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C29H33F3O5Si/c1-29(2,3)38(21-11-7-5-8-12-21,22-13-9-6-10-14-22)37-16-15-25(36-19-35-4)26(28(33)34)20-17-23(30)27(32)24(31)18-20/h5-14,17-18,25-26H,15-16,19H2,1-4H3,(H,33,34)/t25-,26+/m1/s1 |
| InChIKey | UNYHWGYVGLRWBZ-FTJBHMTQSA-N |
| XLogP | 5.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|