C19H18FN7O — CID 68524394
(2R)-2-[2-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]purin-9-yl]-2-(4-fluorophenyl)ethanol (PubChem CID 68524394) has the molecular formula C19H18FN7O and a molecular weight of 379.40 g/mol. Its IUPAC name is (2R)-2-[2-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]purin-9-yl]-2-(4-fluorophenyl)ethanol.
| Compound Name | (2R)-2-[2-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]purin-9-yl]-2-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 68524394 |
| Molecular Formula | C19H18FN7O |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (2R)-2-[2-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]purin-9-yl]-2-(4-fluorophenyl)ethanol |
| SMILES | OC[C@@H](c1ccc(F)cc1)n1cnc2cnc(Nc3cc(C4CC4)[nH]n3)nc21 |
| InChI | InChI=1S/C19H18FN7O/c20-13-5-3-12(4-6-13)16(9-28)27-10-22-15-8-21-19(24-18(15)27)23-17-7-14(25-26-17)11-1-2-11/h3-8,10-11,16,28H,1-2,9H2,(H2,21,23,24,25,26)/t16-/m0/s1 |
| InChIKey | TYGCQFIBGXGTGE-INIZCTEOSA-N |
| XLogP | 2.89 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |