About [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate
[1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate (PubChem CID 68524613) has the molecular formula C23H27FN4O5
and a molecular weight of 458.49 g/mol. Its IUPAC name is [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate |
| PubChem CID | 68524613 |
| Molecular Formula | C23H27FN4O5 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate |
| SMILES | CCOc1cc(CN2CCC(n3nnc4cc(OC(=O)O)ccc43)CC2)cc(OCC)c1F |
| InChI | InChI=1S/C23H27FN4O5/c1-3-31-20-11-15(12-21(22(20)24)32-4-2)14-27-9-7-16(8-10-27)28-19-6-5-17(33-23(29)30)13-18(19)25-26-28/h5-6,11-13,16H,3-4,7-10,14H2,1-2H3,(H,29,30) |
| InChIKey | PCBFGYVEVDRBAM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate?
The IUPAC name of [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate (CID 68524613) is [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate.
What is the SMILES notation for [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate?
The canonical SMILES for [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate is CCOc1cc(CN2CCC(n3nnc4cc(OC(=O)O)ccc43)CC2)cc(OCC)c1F.
What is the InChIKey of [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate?
The InChIKey is PCBFGYVEVDRBAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27FN4O5/c1-3-31-20-11-15(12-21(22(20)24)32-4-2)14-27-9-7-16(8-10-27)28-19-6-5-17(33-23(29)30)13-18(19)25-26-28/h5-6,11-13,16H,3-4,7-10,14H2,1-2H3,(H,29,30).
What are the key properties of [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate?
[1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate has a molecular weight of 458.49 g/mol, XLogP of 4.26, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate is sourced from PubChem (CID 68524613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).