About (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol
(2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol (PubChem CID 68524756) has the molecular formula C13H10F3N3O3
and a molecular weight of 313.24 g/mol. Its IUPAC name is (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol.
Molecular Properties
| Compound Name | (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol |
| PubChem CID | 68524756 |
| Molecular Formula | C13H10F3N3O3 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol |
| SMILES | O=[N+]([O-])c1cc(F)c(F)nc1N[C@@H](CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10F3N3O3/c14-8-3-1-7(2-4-8)10(6-20)17-13-11(19(21)22)5-9(15)12(16)18-13/h1-5,10,20H,6H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | VJGBIGUKRYXPMX-JTQLQIEISA-N |
| XLogP | 2.55 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol?
The IUPAC name of (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol (CID 68524756) is (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol.
What is the SMILES notation for (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol?
The canonical SMILES for (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol is O=[N+]([O-])c1cc(F)c(F)nc1N[C@@H](CO)c1ccc(F)cc1.
What is the InChIKey of (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol?
The InChIKey is VJGBIGUKRYXPMX-JTQLQIEISA-N. The full InChI is InChI=1S/C13H10F3N3O3/c14-8-3-1-7(2-4-8)10(6-20)17-13-11(19(21)22)5-9(15)12(16)18-13/h1-5,10,20H,6H2,(H,17,18)/t10-/m0/s1.
What are the key properties of (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol?
(2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol has a molecular weight of 313.24 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(5,6-difluoro-3-nitro-2-pyridinyl)amino]-2-(4-fluorophenyl)ethanol is sourced from PubChem (CID 68524756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).