About N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide
N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide (PubChem CID 685250) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide.
Molecular Properties
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide |
| PubChem CID | 685250 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide |
| SMILES | CC(=O)NNc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C8H12N4O/c1-5-4-6(2)10-8(9-5)12-11-7(3)13/h4H,1-3H3,(H,11,13)(H,9,10,12) |
| InChIKey | JEJNMUAFUCSXCU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide?
The IUPAC name of N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide (CID 685250) is N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide.
What is the SMILES notation for N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide?
The canonical SMILES for N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide is CC(=O)NNc1nc(C)cc(C)n1.
What is the InChIKey of N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide?
The InChIKey is JEJNMUAFUCSXCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-5-4-6(2)10-8(9-5)12-11-7(3)13/h4H,1-3H3,(H,11,13)(H,9,10,12).
What are the key properties of N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide?
N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide has a molecular weight of 180.21 g/mol, XLogP of 0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,6-dimethylpyrimidin-2-yl)acetohydrazide is sourced from PubChem (CID 685250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).