About tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine
tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 68525096) has the molecular formula C9H15K3N5O+3
and a molecular weight of 326.55 g/mol. Its IUPAC name is tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine |
| PubChem CID | 68525096 |
| Molecular Formula | C9H15K3N5O+3 |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | [H]/N=c1\nc(N2CCCCC2)cc(N)n1O.[K+].[K+].[K+] |
| InChI | InChI=1S/C9H15N5O.3K/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13;;;/h6,11,15H,1-5,10H2;;;/q;3*+1/b11-9+;;; |
| InChIKey | FOUFBJRDTGLAAR-OOQPXJNPSA-N |
| XLogP | -8.82 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | -8.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine?
The IUPAC name of tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine (CID 68525096) is tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine.
What is the SMILES notation for tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine?
The canonical SMILES for tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine is [H]/N=c1\nc(N2CCCCC2)cc(N)n1O.[K+].[K+].[K+].
What is the InChIKey of tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine?
The InChIKey is FOUFBJRDTGLAAR-OOQPXJNPSA-N. The full InChI is InChI=1S/C9H15N5O.3K/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13;;;/h6,11,15H,1-5,10H2;;;/q;3*+1/b11-9+;;;.
What are the key properties of tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine?
tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine has a molecular weight of 326.55 g/mol, XLogP of -8.82, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine is sourced from PubChem (CID 68525096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).