C19H18F2N2O4S — CID 68525246
1-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 68525246) has the molecular formula C19H18F2N2O4S and a molecular weight of 408.43 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 1-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 68525246 |
| Molecular Formula | C19H18F2N2O4S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2ccccc2N1C1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H18F2N2O4S/c20-14-5-6-18(16(21)11-14)28(25,26)22-9-7-15(8-10-22)23-17-4-2-1-3-13(17)12-27-19(23)24/h1-6,11,15H,7-10,12H2 |
| InChIKey | LMKUGMVAICYFTH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |