C26H17Cl2NO4 — CID 68526564
(4-aminophenyl) 4-[4-(2,4-dichlorophenoxy)carbonylphenyl]benzoate (PubChem CID 68526564) has the molecular formula C26H17Cl2NO4 and a molecular weight of 478.33 g/mol. Its IUPAC name is (4-aminophenyl) 4-[4-(2,4-dichlorophenoxy)carbonylphenyl]benzoate.
| Compound Name | (4-aminophenyl) 4-[4-(2,4-dichlorophenoxy)carbonylphenyl]benzoate |
|---|---|
| PubChem CID | 68526564 |
| Molecular Formula | C26H17Cl2NO4 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | (4-aminophenyl) 4-[4-(2,4-dichlorophenoxy)carbonylphenyl]benzoate |
| SMILES | Nc1ccc(OC(=O)c2ccc(-c3ccc(C(=O)Oc4ccc(Cl)cc4Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H17Cl2NO4/c27-20-9-14-24(23(28)15-20)33-26(31)19-7-3-17(4-8-19)16-1-5-18(6-2-16)25(30)32-22-12-10-21(29)11-13-22/h1-15H,29H2 |
| InChIKey | GPQFUVJOAZVMCB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|