About 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid
3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid (PubChem CID 68526616) has the molecular formula C8H6N2O3S
and a molecular weight of 210.21 g/mol. Its IUPAC name is 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid.
Molecular Properties
| Compound Name | 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid |
| PubChem CID | 68526616 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid |
| SMILES | O=S(O)c1cccc(-c2ncon2)c1 |
| InChI | InChI=1S/C8H6N2O3S/c11-14(12)7-3-1-2-6(4-7)8-9-5-13-10-8/h1-5H,(H,11,12) |
| InChIKey | ODJGMEBXAOJHCU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid?
The IUPAC name of 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid (CID 68526616) is 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid.
What is the SMILES notation for 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid?
The canonical SMILES for 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid is O=S(O)c1cccc(-c2ncon2)c1.
What is the InChIKey of 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid?
The InChIKey is ODJGMEBXAOJHCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3S/c11-14(12)7-3-1-2-6(4-7)8-9-5-13-10-8/h1-5H,(H,11,12).
What are the key properties of 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid?
3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid has a molecular weight of 210.21 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-oxadiazol-3-yl)benzenesulfinic acid is sourced from PubChem (CID 68526616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).