About 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine
7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 68526712) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine.
Molecular Properties
| Compound Name | 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine |
| PubChem CID | 68526712 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | C1=C(C2=NCCCCC2)CCCCC1 |
| InChI | InChI=1S/C13H21N/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h8H,1-7,9-11H2 |
| InChIKey | BUHYDABFXSKZHQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine?
The IUPAC name of 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine (CID 68526712) is 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine.
What is the SMILES notation for 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine?
The canonical SMILES for 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine is C1=C(C2=NCCCCC2)CCCCC1.
What is the InChIKey of 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine?
The InChIKey is BUHYDABFXSKZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h8H,1-7,9-11H2.
What are the key properties of 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine?
7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine has a molecular weight of 191.32 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(cyclohepten-1-yl)-3,4,5,6-tetrahydro-2H-azepine is sourced from PubChem (CID 68526712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).