About 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine (PubChem CID 68527248) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine.
Molecular Properties
| Compound Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine |
| PubChem CID | 68527248 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine |
| SMILES | C1=CCCC(C(C2=COC=CO2)N2CCNCC2)=C1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-4-13(5-3-1)15(14-12-18-10-11-19-14)17-8-6-16-7-9-17/h1-2,4,10-12,15-16H,3,5-9H2 |
| InChIKey | VLUZXVGJDLMFEB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine?
The IUPAC name of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine (CID 68527248) is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine.
What is the SMILES notation for 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine?
The canonical SMILES for 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine is C1=CCCC(C(C2=COC=CO2)N2CCNCC2)=C1.
What is the InChIKey of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine?
The InChIKey is VLUZXVGJDLMFEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-2-4-13(5-3-1)15(14-12-18-10-11-19-14)17-8-6-16-7-9-17/h1-2,4,10-12,15-16H,3,5-9H2.
What are the key properties of 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine?
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine has a molecular weight of 260.34 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperazine is sourced from PubChem (CID 68527248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).