C20H22N4O4S2 — CID 68527302
6-methyl-1-[1-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one (PubChem CID 68527302) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 6-methyl-1-[1-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one.
| Compound Name | 6-methyl-1-[1-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 68527302 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 6-methyl-1-[1-(2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-ylsulfonyl)piperidin-4-yl]-4H-3,1-benzoxazin-2-one |
| SMILES | Cc1ccc2c(c1)COC(=O)N2C1CCN(S(=O)(=O)C2=CC=CN3SNC=C23)CC1 |
| InChI | InChI=1S/C20H22N4O4S2/c1-14-4-5-17-15(11-14)13-28-20(25)24(17)16-6-9-22(10-7-16)30(26,27)19-3-2-8-23-18(19)12-21-29-23/h2-5,8,11-12,16,21H,6-7,9-10,13H2,1H3 |
| InChIKey | BOTDJAIZSKITBB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|