C11H14N2O3 — CID 68527440
methyl 1-methyl-4-oxo-5,6,7,8-tetrahydrocyclohepta[d]pyrazole-5-carboxylate (PubChem CID 68527440) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl 1-methyl-4-oxo-5,6,7,8-tetrahydrocyclohepta[d]pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-4-oxo-5,6,7,8-tetrahydrocyclohepta[d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 68527440 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | methyl 1-methyl-4-oxo-5,6,7,8-tetrahydrocyclohepta[d]pyrazole-5-carboxylate |
| SMILES | COC(=O)C1CCCc2c(cnn2C)C1=O |
| InChI | InChI=1S/C11H14N2O3/c1-13-9-5-3-4-7(11(15)16-2)10(14)8(9)6-12-13/h6-7H,3-5H2,1-2H3 |
| InChIKey | HHCWHYMPLCMKFW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|