C23H30N2O3 — CID 68527593
2-[[4-(3,3,5,5-tetramethylcyclohexyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one (PubChem CID 68527593) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-[[4-(3,3,5,5-tetramethylcyclohexyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-[[4-(3,3,5,5-tetramethylcyclohexyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 68527593 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-[[4-(3,3,5,5-tetramethylcyclohexyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one |
| SMILES | CC1(C)CC(c2ccc(OCC3Cn4ccc(=O)nc4O3)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C23H30N2O3/c1-22(2)11-17(12-23(3,4)15-22)16-5-7-18(8-6-16)27-14-19-13-25-10-9-20(26)24-21(25)28-19/h5-10,17,19H,11-15H2,1-4H3 |
| InChIKey | YZLLGWGAVQKXCF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |