About 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol
1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol (PubChem CID 68529032) has the molecular formula C10H20O5
and a molecular weight of 220.26 g/mol. Its IUPAC name is 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol.
Molecular Properties
| Compound Name | 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol |
| PubChem CID | 68529032 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol |
| SMILES | OCCOC(CO)C1(O)CCC(O)CC1 |
| InChI | InChI=1S/C10H20O5/c11-5-6-15-9(7-12)10(14)3-1-8(13)2-4-10/h8-9,11-14H,1-7H2 |
| InChIKey | SFKYXRYKEWUZBY-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol?
The IUPAC name of 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol (CID 68529032) is 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol.
What is the SMILES notation for 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol?
The canonical SMILES for 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol is OCCOC(CO)C1(O)CCC(O)CC1.
What is the InChIKey of 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol?
The InChIKey is SFKYXRYKEWUZBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5/c11-5-6-15-9(7-12)10(14)3-1-8(13)2-4-10/h8-9,11-14H,1-7H2.
What are the key properties of 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol?
1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol has a molecular weight of 220.26 g/mol, XLogP of -0.98, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-hydroxy-1-(2-hydroxyethoxy)ethyl]cyclohexane-1,4-diol is sourced from PubChem (CID 68529032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).