C24H39N5O2 — CID 68529058
N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylbutanamide (PubChem CID 68529058) has the molecular formula C24H39N5O2 and a molecular weight of 429.61 g/mol. Its IUPAC name is N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylbutanamide.
| Compound Name | N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylbutanamide |
|---|---|
| PubChem CID | 68529058 |
| Molecular Formula | C24H39N5O2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)N[C@@H](CC1CCCC2CCCCC21)C(=O)NCc1ccc(N)nc1 |
| InChI | InChI=1S/C24H39N5O2/c1-15(2)22(26)24(31)29-20(23(30)28-14-16-10-11-21(25)27-13-16)12-18-8-5-7-17-6-3-4-9-19(17)18/h10-11,13,15,17-20,22H,3-9,12,14,26H2,1-2H3,(H2,25,27)(H,28,30)(H,29,31)/t17?,18?,19?,20-,22?/m0/s1 |
| InChIKey | LISXFWPXAVXGQA-QPCUBCJCSA-N |
| XLogP | 2.74 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |