About 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid
2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid (PubChem CID 68529367) has the molecular formula C17H17N3O2S
and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid |
| PubChem CID | 68529367 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C#CCN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H17N3O2S/c21-16(22)15-6-2-1-4-14(15)5-3-8-19-9-11-20(12-10-19)17-18-7-13-23-17/h1-2,4,6-7,13H,8-12H2,(H,21,22) |
| InChIKey | OWMNCZJXKGULPF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid?
The IUPAC name of 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid (CID 68529367) is 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid.
What is the SMILES notation for 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid?
The canonical SMILES for 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid is O=C(O)c1ccccc1C#CCN1CCN(c2nccs2)CC1.
What is the InChIKey of 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid?
The InChIKey is OWMNCZJXKGULPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2S/c21-16(22)15-6-2-1-4-14(15)5-3-8-19-9-11-20(12-10-19)17-18-7-13-23-17/h1-2,4,6-7,13H,8-12H2,(H,21,22).
What are the key properties of 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid?
2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid has a molecular weight of 327.41 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]prop-1-ynyl]benzoic acid is sourced from PubChem (CID 68529367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).