C14H16FNO6 — CID 68529814
[(2R,3S,4S,5R,6S)-3,5,6-trihydroxy-4-(1H-indol-2-yloxy)oxan-2-yl]methyl hypofluorite (PubChem CID 68529814) has the molecular formula C14H16FNO6 and a molecular weight of 313.28 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,5,6-trihydroxy-4-(1H-indol-2-yloxy)oxan-2-yl]methyl hypofluorite.
| Compound Name | [(2R,3S,4S,5R,6S)-3,5,6-trihydroxy-4-(1H-indol-2-yloxy)oxan-2-yl]methyl hypofluorite |
|---|---|
| PubChem CID | 68529814 |
| Molecular Formula | C14H16FNO6 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,5,6-trihydroxy-4-(1H-indol-2-yloxy)oxan-2-yl]methyl hypofluorite |
| SMILES | O[C@@H]1[C@@H](Oc2cc3ccccc3[nH]2)[C@@H](O)[C@@H](COF)O[C@@H]1O |
| InChI | InChI=1S/C14H16FNO6/c15-20-6-9-11(17)13(12(18)14(19)21-9)22-10-5-7-3-1-2-4-8(7)16-10/h1-5,9,11-14,16-19H,6H2/t9-,11+,12-,13+,14+/m1/s1 |
| InChIKey | QNHDKOFEOZKCRM-NGBXAZJTSA-N |
| XLogP | 0.26 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |