C11H20F3N3O3 — CID 68529949
3-(4-aminocyclohexyl)-1,1-dimethylurea;2,2,2-trifluoroacetic acid (PubChem CID 68529949) has the molecular formula C11H20F3N3O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-(4-aminocyclohexyl)-1,1-dimethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(4-aminocyclohexyl)-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68529949 |
| Molecular Formula | C11H20F3N3O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3-(4-aminocyclohexyl)-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)NC1CCC(N)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H19N3O.C2HF3O2/c1-12(2)9(13)11-8-5-3-7(10)4-6-8;3-2(4,5)1(6)7/h7-8H,3-6,10H2,1-2H3,(H,11,13);(H,6,7) |
| InChIKey | ZIQVPVWEAVCHMV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |