C18H19FN4O — CID 68530064
5-fluoro-3-(piperidin-3-ylmethoxy)-1-pyridin-2-ylindazole (PubChem CID 68530064) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 5-fluoro-3-(piperidin-3-ylmethoxy)-1-pyridin-2-ylindazole.
| Compound Name | 5-fluoro-3-(piperidin-3-ylmethoxy)-1-pyridin-2-ylindazole |
|---|---|
| PubChem CID | 68530064 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 5-fluoro-3-(piperidin-3-ylmethoxy)-1-pyridin-2-ylindazole |
| SMILES | Fc1ccc2c(c1)c(OCC1CCCNC1)nn2-c1ccccn1 |
| InChI | InChI=1S/C18H19FN4O/c19-14-6-7-16-15(10-14)18(24-12-13-4-3-8-20-11-13)22-23(16)17-5-1-2-9-21-17/h1-2,5-7,9-10,13,20H,3-4,8,11-12H2 |
| InChIKey | WWMSFYZYVYJGCD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |