C20H17F2N3O2 — CID 68530361
1-(2,4-difluorophenyl)-3-[2-(2-ethylphenoxy)-3-pyridinyl]urea (PubChem CID 68530361) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-(2-ethylphenoxy)-3-pyridinyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-(2-ethylphenoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 68530361 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-(2-ethylphenoxy)-3-pyridinyl]urea |
| SMILES | CCc1ccccc1Oc1ncccc1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H17F2N3O2/c1-2-13-6-3-4-8-18(13)27-19-17(7-5-11-23-19)25-20(26)24-16-10-9-14(21)12-15(16)22/h3-12H,2H2,1H3,(H2,24,25,26) |
| InChIKey | SBMVKIALGJUPLA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |