About [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid
[1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid (PubChem CID 68530384) has the molecular formula C17H16F2N2O3
and a molecular weight of 334.32 g/mol. Its IUPAC name is [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid.
Molecular Properties
| Compound Name | [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid |
| PubChem CID | 68530384 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid |
| SMILES | O=C(O)NCC1(COc2cncc(-c3cc(F)ccc3F)c2)CC1 |
| InChI | InChI=1S/C17H16F2N2O3/c18-12-1-2-15(19)14(6-12)11-5-13(8-20-7-11)24-10-17(3-4-17)9-21-16(22)23/h1-2,5-8,21H,3-4,9-10H2,(H,22,23) |
| InChIKey | YSSHILWWKHGLRN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid?
The IUPAC name of [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid (CID 68530384) is [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid.
What is the SMILES notation for [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid?
The canonical SMILES for [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid is O=C(O)NCC1(COc2cncc(-c3cc(F)ccc3F)c2)CC1.
What is the InChIKey of [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid?
The InChIKey is YSSHILWWKHGLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N2O3/c18-12-1-2-15(19)14(6-12)11-5-13(8-20-7-11)24-10-17(3-4-17)9-21-16(22)23/h1-2,5-8,21H,3-4,9-10H2,(H,22,23).
What are the key properties of [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid?
[1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid has a molecular weight of 334.32 g/mol, XLogP of 3.45, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[5-(2,5-difluorophenyl)-3-pyridinyl]oxymethyl]cyclopropyl]methylcarbamic acid is sourced from PubChem (CID 68530384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).