About 1,4-dioxan-2-yl 2-ethyloctanoate
1,4-dioxan-2-yl 2-ethyloctanoate (PubChem CID 68531125) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is 1,4-dioxan-2-yl 2-ethyloctanoate.
Molecular Properties
| Compound Name | 1,4-dioxan-2-yl 2-ethyloctanoate |
| PubChem CID | 68531125 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 1,4-dioxan-2-yl 2-ethyloctanoate |
| SMILES | CCCCCCC(CC)C(=O)OC1COCCO1 |
| InChI | InChI=1S/C14H26O4/c1-3-5-6-7-8-12(4-2)14(15)18-13-11-16-9-10-17-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | JAPYEECPUGQSER-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxan-2-yl 2-ethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxan-2-yl 2-ethyloctanoate?
The IUPAC name of 1,4-dioxan-2-yl 2-ethyloctanoate (CID 68531125) is 1,4-dioxan-2-yl 2-ethyloctanoate.
What is the SMILES notation for 1,4-dioxan-2-yl 2-ethyloctanoate?
The canonical SMILES for 1,4-dioxan-2-yl 2-ethyloctanoate is CCCCCCC(CC)C(=O)OC1COCCO1.
What is the InChIKey of 1,4-dioxan-2-yl 2-ethyloctanoate?
The InChIKey is JAPYEECPUGQSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-3-5-6-7-8-12(4-2)14(15)18-13-11-16-9-10-17-13/h12-13H,3-11H2,1-2H3.
What are the key properties of 1,4-dioxan-2-yl 2-ethyloctanoate?
1,4-dioxan-2-yl 2-ethyloctanoate has a molecular weight of 258.36 g/mol, XLogP of 2.90, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxan-2-yl 2-ethyloctanoate is sourced from PubChem (CID 68531125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).