C17H24N2O3 — CID 68532853
2-(1-methylpiperidin-4-yl)oxy-4-pyrrolidin-1-ylbenzoic acid (PubChem CID 68532853) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)oxy-4-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 2-(1-methylpiperidin-4-yl)oxy-4-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 68532853 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)oxy-4-pyrrolidin-1-ylbenzoic acid |
| SMILES | CN1CCC(Oc2cc(N3CCCC3)ccc2C(=O)O)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-18-10-6-14(7-11-18)22-16-12-13(19-8-2-3-9-19)4-5-15(16)17(20)21/h4-5,12,14H,2-3,6-11H2,1H3,(H,20,21) |
| InChIKey | NRZRWZZUZNBANW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |