About 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide
2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide (PubChem CID 68532855) has the molecular formula C22H17F2NO3S
and a molecular weight of 413.45 g/mol. Its IUPAC name is 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide.
Molecular Properties
| Compound Name | 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide |
| PubChem CID | 68532855 |
| Molecular Formula | C22H17F2NO3S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide |
| SMILES | Cc1cc(S(=O)(=O)c2ccccc2C(N)=O)ccc1C=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C22H17F2NO3S/c1-14-12-18(29(27,28)21-5-3-2-4-19(21)22(25)26)11-9-15(14)6-7-16-8-10-17(23)13-20(16)24/h2-13H,1H3,(H2,25,26) |
| InChIKey | BHSGUUFFSHFWKS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide?
The IUPAC name of 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide (CID 68532855) is 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide.
What is the SMILES notation for 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide?
The canonical SMILES for 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide is Cc1cc(S(=O)(=O)c2ccccc2C(N)=O)ccc1C=Cc1ccc(F)cc1F.
What is the InChIKey of 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide?
The InChIKey is BHSGUUFFSHFWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F2NO3S/c1-14-12-18(29(27,28)21-5-3-2-4-19(21)22(25)26)11-9-15(14)6-7-16-8-10-17(23)13-20(16)24/h2-13H,1H3,(H2,25,26).
What are the key properties of 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide?
2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide has a molecular weight of 413.45 g/mol, XLogP of 4.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2,4-difluorophenyl)ethenyl]-3-methylphenyl]sulfonylbenzamide is sourced from PubChem (CID 68532855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).