About 9-bromothianthren-1-ol
9-bromothianthren-1-ol (PubChem CID 68533985) has the molecular formula C12H7BrOS2
and a molecular weight of 311.23 g/mol. Its IUPAC name is 9-bromothianthren-1-ol.
Molecular Properties
| Compound Name | 9-bromothianthren-1-ol |
| PubChem CID | 68533985 |
| Molecular Formula | C12H7BrOS2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 309.91 |
| IUPAC Name | 9-bromothianthren-1-ol |
| SMILES | Oc1cccc2c1Sc1c(Br)cccc1S2 |
| InChI | InChI=1S/C12H7BrOS2/c13-7-3-1-5-9-11(7)16-12-8(14)4-2-6-10(12)15-9/h1-6,14H |
| InChIKey | LUCGHAAYQZOCIO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-bromothianthren-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromothianthren-1-ol?
The IUPAC name of 9-bromothianthren-1-ol (CID 68533985) is 9-bromothianthren-1-ol.
What is the SMILES notation for 9-bromothianthren-1-ol?
The canonical SMILES for 9-bromothianthren-1-ol is Oc1cccc2c1Sc1c(Br)cccc1S2.
What is the InChIKey of 9-bromothianthren-1-ol?
The InChIKey is LUCGHAAYQZOCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrOS2/c13-7-3-1-5-9-11(7)16-12-8(14)4-2-6-10(12)15-9/h1-6,14H.
What are the key properties of 9-bromothianthren-1-ol?
9-bromothianthren-1-ol has a molecular weight of 311.23 g/mol, XLogP of 4.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromothianthren-1-ol is sourced from PubChem (CID 68533985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).