C15H14N2O — CID 68534148
spiro[1,3-dihydroindole-2,3'-2,4-dihydro-1,2-benzoxazine] (PubChem CID 68534148) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is spiro[1,3-dihydroindole-2,3'-2,4-dihydro-1,2-benzoxazine].
| Compound Name | spiro[1,3-dihydroindole-2,3'-2,4-dihydro-1,2-benzoxazine] |
|---|---|
| PubChem CID | 68534148 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | spiro[1,3-dihydroindole-2,3'-2,4-dihydro-1,2-benzoxazine] |
| SMILES | c1ccc2c(c1)CC1(Cc3ccccc3ON1)N2 |
| InChI | InChI=1S/C15H14N2O/c1-3-7-13-11(5-1)9-15(16-13)10-12-6-2-4-8-14(12)18-17-15/h1-8,16-17H,9-10H2 |
| InChIKey | RAIVLUVFNSASBS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |