About 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene
2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene (PubChem CID 68534524) has the molecular formula C28H25F3
and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene.
Molecular Properties
| Compound Name | 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene |
| PubChem CID | 68534524 |
| Molecular Formula | C28H25F3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene |
| SMILES | CCCC(c1cc(F)c(-c2ccc(C)cc2)c(F)c1)C(F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H25F3/c1-3-6-24(28(31)22-14-13-19-7-4-5-8-21(19)15-22)23-16-25(29)27(26(30)17-23)20-11-9-18(2)10-12-20/h4-5,7-17,24,28H,3,6H2,1-2H3 |
| InChIKey | NDEJQBRYQCTYCX-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene?
The IUPAC name of 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene (CID 68534524) is 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene.
What is the SMILES notation for 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene?
The canonical SMILES for 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene is CCCC(c1cc(F)c(-c2ccc(C)cc2)c(F)c1)C(F)c1ccc2ccccc2c1.
What is the InChIKey of 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene?
The InChIKey is NDEJQBRYQCTYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25F3/c1-3-6-24(28(31)22-14-13-19-7-4-5-8-21(19)15-22)23-16-25(29)27(26(30)17-23)20-11-9-18(2)10-12-20/h4-5,7-17,24,28H,3,6H2,1-2H3.
What are the key properties of 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene?
2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene has a molecular weight of 418.50 g/mol, XLogP of 8.69, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[3,5-difluoro-4-(4-methylphenyl)phenyl]-1-fluoropentyl]naphthalene is sourced from PubChem (CID 68534524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).