C13H16N2O — CID 68534665
(1S,3S,5S)-2-benzyl-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 68534665) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S,3S,5S)-2-benzyl-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1S,3S,5S)-2-benzyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 68534665 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (1S,3S,5S)-2-benzyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]2C[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C13H16N2O/c14-13(16)12-7-10-6-11(10)15(12)8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2,(H2,14,16)/t10-,11-,12-/m0/s1 |
| InChIKey | UBHRVDHGXDNBET-SRVKXCTJSA-N |
| XLogP | 1.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |