About 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride
6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride (PubChem CID 68534671) has the molecular formula C12H17ClFNO2
and a molecular weight of 261.72 g/mol. Its IUPAC name is 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride.
Molecular Properties
| Compound Name | 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride |
| PubChem CID | 68534671 |
| Molecular Formula | C12H17ClFNO2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride |
| SMILES | Cl.OC1(Cc2ccccc2F)CNCCOC1 |
| InChI | InChI=1S/C12H16FNO2.ClH/c13-11-4-2-1-3-10(11)7-12(15)8-14-5-6-16-9-12;/h1-4,14-15H,5-9H2;1H |
| InChIKey | USRFRZOZJSXJDG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride?
The IUPAC name of 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride (CID 68534671) is 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride.
What is the SMILES notation for 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride?
The canonical SMILES for 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride is Cl.OC1(Cc2ccccc2F)CNCCOC1.
What is the InChIKey of 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride?
The InChIKey is USRFRZOZJSXJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO2.ClH/c13-11-4-2-1-3-10(11)7-12(15)8-14-5-6-16-9-12;/h1-4,14-15H,5-9H2;1H.
What are the key properties of 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride?
6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride has a molecular weight of 261.72 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-fluorophenyl)methyl]-1,4-oxazepan-6-ol;hydrochloride is sourced from PubChem (CID 68534671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).