About 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde
3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde (PubChem CID 68535270) has the molecular formula C17H20F2N4O2
and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde.
Molecular Properties
| Compound Name | 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde |
| PubChem CID | 68535270 |
| Molecular Formula | C17H20F2N4O2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde |
| SMILES | C=O.Cc1cc(N)cnc1N1CCN(c2ccc(F)c(O)c2F)CC1 |
| InChI | InChI=1S/C16H18F2N4O.CH2O/c1-10-8-11(19)9-20-16(10)22-6-4-21(5-7-22)13-3-2-12(17)15(23)14(13)18;1-2/h2-3,8-9,23H,4-7,19H2,1H3;1H2 |
| InChIKey | ZPLCQPWPJLNUAO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde?
The IUPAC name of 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde (CID 68535270) is 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde.
What is the SMILES notation for 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde?
The canonical SMILES for 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde is C=O.Cc1cc(N)cnc1N1CCN(c2ccc(F)c(O)c2F)CC1.
What is the InChIKey of 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde?
The InChIKey is ZPLCQPWPJLNUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2N4O.CH2O/c1-10-8-11(19)9-20-16(10)22-6-4-21(5-7-22)13-3-2-12(17)15(23)14(13)18;1-2/h2-3,8-9,23H,4-7,19H2,1H3;1H2.
What are the key properties of 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde?
3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde has a molecular weight of 350.37 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(5-amino-3-methyl-2-pyridinyl)piperazin-1-yl]-2,6-difluorophenol;formaldehyde is sourced from PubChem (CID 68535270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).