C29H36NO4+ — CID 68535800
(4R,4aR,7aR,12bS)-7a-benzyl-11-butoxy-9-hydroxy-3,3-dimethyl-2,4,4a,5,6,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 68535800) has the molecular formula C29H36NO4+ and a molecular weight of 462.61 g/mol. Its IUPAC name is (4R,4aR,7aR,12bS)-7a-benzyl-11-butoxy-9-hydroxy-3,3-dimethyl-2,4,4a,5,6,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (4R,4aR,7aR,12bS)-7a-benzyl-11-butoxy-9-hydroxy-3,3-dimethyl-2,4,4a,5,6,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 68535800 |
| Molecular Formula | C29H36NO4+ |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (4R,4aR,7aR,12bS)-7a-benzyl-11-butoxy-9-hydroxy-3,3-dimethyl-2,4,4a,5,6,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | CCCCOc1cc(O)c2c3c1C[C@@H]1[C@@H]4CCC(=O)[C@](Cc5ccccc5)(O2)[C@]34CC[N+]1(C)C |
| InChI | InChI=1S/C29H35NO4/c1-4-5-15-33-24-17-23(31)27-26-20(24)16-22-21-11-12-25(32)29(34-27,18-19-9-7-6-8-10-19)28(21,26)13-14-30(22,2)3/h6-10,17,21-22H,4-5,11-16,18H2,1-3H3/p+1/t21-,22+,28-,29-/m0/s1 |
| InChIKey | OZKZGNNVVUTAKS-XPIHVTCWSA-O |
| XLogP | 4.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|